C31H31N3O6S — CID 98093408
2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 98093408) has the molecular formula C31H31N3O6S and a molecular weight of 573.67 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 98093408 |
| Molecular Formula | C31H31N3O6S |
| Molecular Weight | 573.67 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 2-(3,4-dimethoxy-N-(4-methylphenyl)sulfonylanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C\c2ccccc2OCc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C31H31N3O6S/c1-23-13-16-27(17-14-23)41(36,37)34(26-15-18-29(38-2)30(19-26)39-3)21-31(35)33-32-20-25-11-7-8-12-28(25)40-22-24-9-5-4-6-10-24/h4-20H,21-22H2,1-3H3,(H,33,35)/b32-20- |
| InChIKey | KYULCFMOQHKOJV-RGXNXFOYSA-N |
| XLogP | 4.94 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|