C31H31N3O5S — CID 126372103
2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 126372103) has the molecular formula C31H31N3O5S and a molecular weight of 557.67 g/mol. Its IUPAC name is 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126372103 |
| Molecular Formula | C31H31N3O5S |
| Molecular Weight | 557.67 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)N/N=C/c1ccccc1OCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H31N3O5S/c1-24-17-18-29(38-2)30(19-24)40(36,37)34(21-25-11-5-3-6-12-25)22-31(35)33-32-20-27-15-9-10-16-28(27)39-23-26-13-7-4-8-14-26/h3-20H,21-23H2,1-2H3,(H,33,35)/b32-20+ |
| InChIKey | ADMUEZQKZFUPHC-UZWMFBFFSA-N |
| XLogP | 4.92 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.67 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|