C30H29N3O5S — CID 126372602
2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(3-phenoxyphenyl)methylideneamino]acetamide (PubChem CID 126372602) has the molecular formula C30H29N3O5S and a molecular weight of 543.65 g/mol. Its IUPAC name is 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(3-phenoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(3-phenoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126372602 |
| Molecular Formula | C30H29N3O5S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 2-[benzyl-(2-methoxy-5-methylphenyl)sulfonylamino]-N-[(E)-(3-phenoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N(CC(=O)N/N=C/c1cccc(Oc2ccccc2)c1)Cc1ccccc1 |
| InChI | InChI=1S/C30H29N3O5S/c1-23-16-17-28(37-2)29(18-23)39(35,36)33(21-24-10-5-3-6-11-24)22-30(34)32-31-20-25-12-9-15-27(19-25)38-26-13-7-4-8-14-26/h3-20H,21-22H2,1-2H3,(H,32,34)/b31-20+ |
| InChIKey | JUULUBDHRLRQIS-AJBULDERSA-N |
| XLogP | 5.14 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|