C25H27N3O6S — CID 4563517
2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-[(3-methoxyphenyl)methylideneamino]acetamide (PubChem CID 4563517) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-[(3-methoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-[(3-methoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4563517 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[benzyl-(2,5-dimethoxyphenyl)sulfonylamino]-N-[(3-methoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1cccc(C=NNC(=O)CN(Cc2ccccc2)S(=O)(=O)c2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C25H27N3O6S/c1-32-21-11-7-10-20(14-21)16-26-27-25(29)18-28(17-19-8-5-4-6-9-19)35(30,31)24-15-22(33-2)12-13-23(24)34-3/h4-16H,17-18H2,1-3H3,(H,27,29) |
| InChIKey | RROGXHMLTCSQEN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|