C18H20FN3O5S — CID 92959555
2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-(3-fluorophenyl)methylideneamino]acetamide (PubChem CID 92959555) has the molecular formula C18H20FN3O5S and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-(3-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-(3-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 92959555 |
| Molecular Formula | C18H20FN3O5S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-(3-fluorophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(C)CC(=O)N/N=C/c2cccc(F)c2)c1 |
| InChI | InChI=1S/C18H20FN3O5S/c1-22(12-18(23)21-20-11-13-5-4-6-14(19)9-13)28(24,25)17-10-15(26-2)7-8-16(17)27-3/h4-11H,12H2,1-3H3,(H,21,23)/b20-11+ |
| InChIKey | BZMKAZRSCKGXLJ-RGVLZGJSSA-N |
| XLogP | 1.61 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|