C17H20N4O5S — CID 93032624
2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide (PubChem CID 93032624) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 93032624 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(E)-pyridin-3-ylmethylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(C)CC(=O)N/N=C/c2cccnc2)c1 |
| InChI | InChI=1S/C17H20N4O5S/c1-21(12-17(22)20-19-11-13-5-4-8-18-10-13)27(23,24)16-9-14(25-2)6-7-15(16)26-3/h4-11H,12H2,1-3H3,(H,20,22)/b19-11+ |
| InChIKey | LMYZKSYMFHECSW-YBFXNURJSA-N |
| XLogP | 0.87 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|