C21H27N3O8S — CID 4574084
2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 4574084) has the molecular formula C21H27N3O8S and a molecular weight of 481.53 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4574084 |
| Molecular Formula | C21H27N3O8S |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]-N-[(2,3,4-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(C)CC(=O)NN=Cc2ccc(OC)c(OC)c2OC)c1 |
| InChI | InChI=1S/C21H27N3O8S/c1-24(33(26,27)18-11-15(28-2)8-10-16(18)29-3)13-19(25)23-22-12-14-7-9-17(30-4)21(32-6)20(14)31-5/h7-12H,13H2,1-6H3,(H,23,25) |
| InChIKey | WYCUEDPJKQDBCM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 124.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|