C18H19Cl2N3O5S — CID 4203841
N-[(2,4-dichlorophenyl)methylideneamino]-2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]acetamide (PubChem CID 4203841) has the molecular formula C18H19Cl2N3O5S and a molecular weight of 460.34 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]acetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]acetamide |
|---|---|
| PubChem CID | 4203841 |
| Molecular Formula | C18H19Cl2N3O5S |
| Molecular Weight | 460.34 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-[(2,5-dimethoxyphenyl)sulfonyl-methylamino]acetamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(C)CC(=O)NN=Cc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H19Cl2N3O5S/c1-23(29(25,26)17-9-14(27-2)6-7-16(17)28-3)11-18(24)22-21-10-12-4-5-13(19)8-15(12)20/h4-10H,11H2,1-3H3,(H,22,24) |
| InChIKey | BHLBIKLSHHMARY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|