C24H23Cl2N3O6S — CID 3936018
N-[(2,4-dichlorophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide (PubChem CID 3936018) has the molecular formula C24H23Cl2N3O6S and a molecular weight of 552.44 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide.
| Compound Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide |
|---|---|
| PubChem CID | 3936018 |
| Molecular Formula | C24H23Cl2N3O6S |
| Molecular Weight | 552.44 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methoxyanilino)acetamide |
| SMILES | COc1ccc(N(CC(=O)NN=Cc2ccc(Cl)cc2Cl)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C24H23Cl2N3O6S/c1-33-19-8-6-18(7-9-19)29(36(31,32)20-10-11-22(34-2)23(13-20)35-3)15-24(30)28-27-14-16-4-5-17(25)12-21(16)26/h4-14H,15H2,1-3H3,(H,28,30) |
| InChIKey | OYYMXMMIDFWZDQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|