C23H21F2N3O5S — CID 126146123
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide (PubChem CID 126146123) has the molecular formula C23H21F2N3O5S and a molecular weight of 489.50 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126146123 |
| Molecular Formula | C23H21F2N3O5S |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-fluoroanilino)-N-[(Z)-(2-fluorophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccccc2F)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C23H21F2N3O5S/c1-32-21-12-11-19(13-22(21)33-2)34(30,31)28(18-9-7-17(24)8-10-18)15-23(29)27-26-14-16-5-3-4-6-20(16)25/h3-14H,15H2,1-2H3,(H,27,29)/b26-14- |
| InChIKey | OXMQJKYXTFBLHQ-WGARJPEWSA-N |
| XLogP | 3.33 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|