C25H27N3O8S — CID 135699605
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135699605) has the molecular formula C25H27N3O8S and a molecular weight of 529.57 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135699605 |
| Molecular Formula | C25H27N3O8S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(2-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2ccccc2O)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C25H27N3O8S/c1-33-18-9-11-22(34-2)20(13-18)28(16-25(30)27-26-15-17-7-5-6-8-21(17)29)37(31,32)19-10-12-23(35-3)24(14-19)36-4/h5-15,29H,16H2,1-4H3,(H,27,30)/b26-15- |
| InChIKey | IDDQDWALZRBHCN-YSMPRRRNSA-N |
| XLogP | 2.77 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|