C34H36N4O9S — CID 126122771
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126122771) has the molecular formula C34H36N4O9S and a molecular weight of 676.75 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126122771 |
| Molecular Formula | C34H36N4O9S |
| Molecular Weight | 676.75 g/mol |
| Exact Mass | 676.22 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2ccc(OCC(=O)Nc3ccc(C)cc3)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C34H36N4O9S/c1-23-6-10-25(11-7-23)36-34(40)22-47-26-12-8-24(9-13-26)20-35-37-33(39)21-38(29-18-27(43-2)14-16-30(29)44-3)48(41,42)28-15-17-31(45-4)32(19-28)46-5/h6-20H,21-22H2,1-5H3,(H,36,40)(H,37,39)/b35-20- |
| InChIKey | PIUQRZNTFHUEFJ-OJYCWLPVSA-N |
| XLogP | 4.39 |
| TPSA | 154.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|