C32H31N3O9S — CID 126145030
[4-[(Z)-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate (PubChem CID 126145030) has the molecular formula C32H31N3O9S and a molecular weight of 633.68 g/mol. Its IUPAC name is [4-[(Z)-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate.
| Compound Name | [4-[(Z)-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
|---|---|
| PubChem CID | 126145030 |
| Molecular Formula | C32H31N3O9S |
| Molecular Weight | 633.68 g/mol |
| Exact Mass | 633.18 |
| IUPAC Name | [4-[(Z)-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)acetyl]hydrazinylidene]methyl]phenyl] benzoate |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2ccc(OC(=O)c3ccccc3)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C32H31N3O9S/c1-40-25-14-16-28(41-2)27(18-25)35(45(38,39)26-15-17-29(42-3)30(19-26)43-4)21-31(36)34-33-20-22-10-12-24(13-11-22)44-32(37)23-8-6-5-7-9-23/h5-20H,21H2,1-4H3,(H,34,36)/b33-20- |
| InChIKey | HHVXBNKBQYGGKF-UCMJSZAQSA-N |
| XLogP | 4.29 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.68 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|