C28H33N3O10S — CID 126117774
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 126117774) has the molecular formula C28H33N3O10S and a molecular weight of 603.65 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126117774 |
| Molecular Formula | C28H33N3O10S |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2cc(OC)c(OC)c(OC)c2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C28H33N3O10S/c1-35-19-8-10-22(36-2)21(14-19)31(42(33,34)20-9-11-23(37-3)24(15-20)38-4)17-27(32)30-29-16-18-12-25(39-5)28(41-7)26(13-18)40-6/h8-16H,17H2,1-7H3,(H,30,32)/b29-16- |
| InChIKey | CIKHCJHHZRUHOL-MWLSYYOVSA-N |
| XLogP | 3.09 |
| TPSA | 143.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|