C28H33N3O8S — CID 126115651
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(4-propan-2-yloxyphenyl)methylideneamino]acetamide (PubChem CID 126115651) has the molecular formula C28H33N3O8S and a molecular weight of 571.65 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(4-propan-2-yloxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(4-propan-2-yloxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126115651 |
| Molecular Formula | C28H33N3O8S |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(4-propan-2-yloxyphenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2ccc(OC(C)C)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C28H33N3O8S/c1-19(2)39-21-9-7-20(8-10-21)17-29-30-28(32)18-31(24-15-22(35-3)11-13-25(24)36-4)40(33,34)23-12-14-26(37-5)27(16-23)38-6/h7-17,19H,18H2,1-6H3,(H,30,32)/b29-17- |
| InChIKey | BSILYBKGZUFOKP-RHANQZHGSA-N |
| XLogP | 3.85 |
| TPSA | 124.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|