C25H26FN3O7S — CID 126146573
2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide (PubChem CID 126146573) has the molecular formula C25H26FN3O7S and a molecular weight of 531.56 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126146573 |
| Molecular Formula | C25H26FN3O7S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-2,5-dimethoxyanilino)-N-[(Z)-(3-fluorophenyl)methylideneamino]acetamide |
| SMILES | COc1ccc(OC)c(N(CC(=O)N/N=C\c2cccc(F)c2)S(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C25H26FN3O7S/c1-33-19-8-10-22(34-2)21(13-19)29(16-25(30)28-27-15-17-6-5-7-18(26)12-17)37(31,32)20-9-11-23(35-3)24(14-20)36-4/h5-15H,16H2,1-4H3,(H,28,30)/b27-15- |
| InChIKey | DHDKYALGFCULQQ-DICXZTSXSA-N |
| XLogP | 3.21 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|