C26H27N3O9S — CID 124535245
[4-[(Z)-[[2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 124535245) has the molecular formula C26H27N3O9S and a molecular weight of 557.58 g/mol. Its IUPAC name is [4-[(Z)-[[2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(Z)-[[2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 124535245 |
| Molecular Formula | C26H27N3O9S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | [4-[(Z)-[[2-[N-(benzenesulfonyl)-2,5-dimethoxyanilino]acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccc(/C=N\NC(=O)CN(c2cc(OC)ccc2OC)S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H27N3O9S/c1-34-19-11-13-22(35-2)21(15-19)29(39(32,33)20-8-6-5-7-9-20)17-25(30)28-27-16-18-10-12-23(24(14-18)36-3)38-26(31)37-4/h5-16H,17H2,1-4H3,(H,28,30)/b27-16- |
| InChIKey | AZFAOPDPXFLLCR-YUMHPJSZSA-N |
| XLogP | 3.20 |
| TPSA | 142.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|