C26H27N3O8S — CID 43882059
[4-[(E)-[[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate (PubChem CID 43882059) has the molecular formula C26H27N3O8S and a molecular weight of 541.58 g/mol. Its IUPAC name is [4-[(E)-[[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate.
| Compound Name | [4-[(E)-[[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
|---|---|
| PubChem CID | 43882059 |
| Molecular Formula | C26H27N3O8S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | [4-[(E)-[[2-(N-(4-ethoxyphenyl)sulfonylanilino)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] methyl carbonate |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC(=O)N/N=C/c2ccc(OC(=O)OC)c(OC)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O8S/c1-4-36-21-11-13-22(14-12-21)38(32,33)29(20-8-6-5-7-9-20)18-25(30)28-27-17-19-10-15-23(24(16-19)34-2)37-26(31)35-3/h5-17H,4,18H2,1-3H3,(H,28,30)/b27-17+ |
| InChIKey | AKNNZJLGKVXKPZ-WPWMEQJKSA-N |
| XLogP | 3.58 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|