C29H36N4O6S — CID 126034675
N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 126034675) has the molecular formula C29H36N4O6S and a molecular weight of 568.70 g/mol. Its IUPAC name is N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126034675 |
| Molecular Formula | C29H36N4O6S |
| Molecular Weight | 568.70 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | N-[(Z)-[4-(diethylamino)phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2ccc(N(CC)CC)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C29H36N4O6S/c1-6-32(7-2)23-11-9-22(10-12-23)20-30-31-29(34)21-33(24-13-15-25(16-14-24)39-8-3)40(35,36)26-17-18-27(37-4)28(19-26)38-5/h9-20H,6-8,21H2,1-5H3,(H,31,34)/b30-20- |
| InChIKey | KCIDTHVECKHDNO-COEJQBHMSA-N |
| XLogP | 4.29 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.70 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|