C32H32ClN3O7S — CID 126035479
N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide (PubChem CID 126035479) has the molecular formula C32H32ClN3O7S and a molecular weight of 638.14 g/mol. Its IUPAC name is N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
|---|---|
| PubChem CID | 126035479 |
| Molecular Formula | C32H32ClN3O7S |
| Molecular Weight | 638.14 g/mol |
| Exact Mass | 637.16 |
| IUPAC Name | N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)N/N=C\c2ccc(OCc3cccc(Cl)c3)cc2)S(=O)(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H32ClN3O7S/c1-4-42-27-14-10-26(11-15-27)36(44(38,39)29-16-17-30(40-2)31(19-29)41-3)21-32(37)35-34-20-23-8-12-28(13-9-23)43-22-24-6-5-7-25(33)18-24/h5-20H,4,21-22H2,1-3H3,(H,35,37)/b34-20- |
| InChIKey | UPGXWESLXCSTDN-GXBUFBABSA-N |
| XLogP | 5.68 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.14 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|