C33H28ClN3O5S — CID 126143655
2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126143655) has the molecular formula C33H28ClN3O5S and a molecular weight of 614.12 g/mol. Its IUPAC name is 2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126143655 |
| Molecular Formula | C33H28ClN3O5S |
| Molecular Weight | 614.12 g/mol |
| Exact Mass | 613.14 |
| IUPAC Name | 2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(OCc3ccc4ccccc4c3)cc2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C33H28ClN3O5S/c1-41-30-15-17-32(18-16-30)43(39,40)37(29-8-4-7-28(34)20-29)22-33(38)36-35-21-24-10-13-31(14-11-24)42-23-25-9-12-26-5-2-3-6-27(26)19-25/h2-21H,22-23H2,1H3,(H,36,38)/b35-21- |
| InChIKey | WPJKURKMCLKNFT-IPHFVPNQSA-N |
| XLogP | 6.43 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.12 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|