C22H19BrClN3O4S — CID 126125629
N-[(Z)-(4-bromophenyl)methylideneamino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide (PubChem CID 126125629) has the molecular formula C22H19BrClN3O4S and a molecular weight of 536.84 g/mol. Its IUPAC name is N-[(Z)-(4-bromophenyl)methylideneamino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(4-bromophenyl)methylideneamino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126125629 |
| Molecular Formula | C22H19BrClN3O4S |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 535.00 |
| IUPAC Name | N-[(Z)-(4-bromophenyl)methylideneamino]-2-(3-chloro-N-(4-methoxyphenyl)sulfonylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C\c2ccc(Br)cc2)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19BrClN3O4S/c1-31-20-9-11-21(12-10-20)32(29,30)27(19-4-2-3-18(24)13-19)15-22(28)26-25-14-16-5-7-17(23)8-6-16/h2-14H,15H2,1H3,(H,26,28)/b25-14- |
| InChIKey | SVKWHSXOLWBYQB-QFEZKATASA-N |
| XLogP | 4.46 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|