C34H30ClN3O4S — CID 126145902
2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide (PubChem CID 126145902) has the molecular formula C34H30ClN3O4S and a molecular weight of 612.15 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126145902 |
| Molecular Formula | C34H30ClN3O4S |
| Molecular Weight | 612.15 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-3,4-dimethylanilino)-N-[(Z)-[4-(naphthalen-2-ylmethoxy)phenyl]methylideneamino]acetamide |
| SMILES | Cc1ccc(N(CC(=O)N/N=C\c2ccc(OCc3ccc4ccccc4c3)cc2)S(=O)(=O)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C34H30ClN3O4S/c1-24-7-14-31(19-25(24)2)38(43(40,41)33-17-12-30(35)13-18-33)22-34(39)37-36-21-26-9-15-32(16-10-26)42-23-27-8-11-28-5-3-4-6-29(28)20-27/h3-21H,22-23H2,1-2H3,(H,37,39)/b36-21- |
| InChIKey | OMWUKTYQPAXCAK-IDWIKUEFSA-N |
| XLogP | 7.03 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.15 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|