C28H22Cl2IN3O4S — CID 126148520
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 126148520) has the molecular formula C28H22Cl2IN3O4S and a molecular weight of 694.38 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126148520 |
| Molecular Formula | C28H22Cl2IN3O4S |
| Molecular Weight | 694.38 g/mol |
| Exact Mass | 692.98 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)N/N=C\c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C28H22Cl2IN3O4S/c29-26-15-8-21(16-27(26)30)19-38-24-13-6-20(7-14-24)17-32-33-28(35)18-34(23-11-9-22(31)10-12-23)39(36,37)25-4-2-1-3-5-25/h1-17H,18-19H2,(H,33,35)/b32-17- |
| InChIKey | WZCWPPCRQYWYGE-KYHGBAKBSA-N |
| XLogP | 6.52 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.38 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|