C29H26N4O7S — CID 6065445
2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 6065445) has the molecular formula C29H26N4O7S and a molecular weight of 574.62 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6065445 |
| Molecular Formula | C29H26N4O7S |
| Molecular Weight | 574.62 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-methoxyanilino]-N-[(Z)-[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | COc1ccc(N(CC(=O)N/N=C\c2ccc(OCc3ccc([N+](=O)[O-])cc3)cc2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N4O7S/c1-39-26-17-13-24(14-18-26)32(41(37,38)28-5-3-2-4-6-28)20-29(34)31-30-19-22-9-15-27(16-10-22)40-21-23-7-11-25(12-8-23)33(35)36/h2-19H,20-21H2,1H3,(H,31,34)/b30-19- |
| InChIKey | LMGMASIPFJUVCC-FSGOGVSDSA-N |
| XLogP | 4.53 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|