C28H23N5O8S — CID 4989233
2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 4989233) has the molecular formula C28H23N5O8S and a molecular weight of 589.59 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 4989233 |
| Molecular Formula | C28H23N5O8S |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.13 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[[4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CN(c1cccc([N+](=O)[O-])c1)S(=O)(=O)c1ccccc1)NN=Cc1ccc(OCc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H23N5O8S/c34-28(19-31(24-5-4-6-25(17-24)33(37)38)42(39,40)27-7-2-1-3-8-27)30-29-18-21-11-15-26(16-12-21)41-20-22-9-13-23(14-10-22)32(35)36/h1-18H,19-20H2,(H,30,34) |
| InChIKey | RXYKYXBISOUFLR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 174.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|