C28H23Cl2N3O4S — CID 126033864
N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide (PubChem CID 126033864) has the molecular formula C28H23Cl2N3O4S and a molecular weight of 568.48 g/mol. Its IUPAC name is N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 126033864 |
| Molecular Formula | C28H23Cl2N3O4S |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | N-[(Z)-[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-(N-(4-chlorophenyl)sulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1)N/N=C\c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H23Cl2N3O4S/c29-23-10-6-22(7-11-23)20-37-26-14-8-21(9-15-26)18-31-32-28(34)19-33(25-4-2-1-3-5-25)38(35,36)27-16-12-24(30)13-17-27/h1-18H,19-20H2,(H,32,34)/b31-18- |
| InChIKey | BWPHFAULOWXLQG-MNBJERMJSA-N |
| XLogP | 5.92 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|