C29H26ClN3O4S — CID 6060424
2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6060424) has the molecular formula C29H26ClN3O4S and a molecular weight of 548.06 g/mol. Its IUPAC name is 2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6060424 |
| Molecular Formula | C29H26ClN3O4S |
| Molecular Weight | 548.06 g/mol |
| Exact Mass | 547.13 |
| IUPAC Name | 2-[benzenesulfonyl-[(4-chlorophenyl)methyl]amino]-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | O=C(CN(Cc1ccc(Cl)cc1)S(=O)(=O)c1ccccc1)N/N=C\c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H26ClN3O4S/c30-26-15-11-24(12-16-26)20-33(38(35,36)28-9-5-2-6-10-28)21-29(34)32-31-19-23-13-17-27(18-14-23)37-22-25-7-3-1-4-8-25/h1-19H,20-22H2,(H,32,34)/b31-19- |
| InChIKey | OPJCTGJSOGNOCH-DXJNIWACSA-N |
| XLogP | 5.26 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|