C28H23ClIN3O4S — CID 126118709
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide (PubChem CID 126118709) has the molecular formula C28H23ClIN3O4S and a molecular weight of 659.93 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126118709 |
| Molecular Formula | C28H23ClIN3O4S |
| Molecular Weight | 659.93 g/mol |
| Exact Mass | 659.01 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)N/N=C\c1ccc(OCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C28H23ClIN3O4S/c29-23-6-4-5-22(17-23)20-37-26-15-9-21(10-16-26)18-31-32-28(34)19-33(25-13-11-24(30)12-14-25)38(35,36)27-7-2-1-3-8-27/h1-18H,19-20H2,(H,32,34)/b31-18- |
| InChIKey | GEHPQDUFDNVVLA-MNBJERMJSA-N |
| XLogP | 5.87 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.93 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|