C30H28N4O7S — CID 6032431
2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 6032431) has the molecular formula C30H28N4O7S and a molecular weight of 588.64 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6032431 |
| Molecular Formula | C30H28N4O7S |
| Molecular Weight | 588.64 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-nitroanilino]-N-[(Z)-(3-ethoxy-4-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc(/C=N\NC(=O)CN(c2cccc([N+](=O)[O-])c2)S(=O)(=O)c2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C30H28N4O7S/c1-2-40-29-18-24(16-17-28(29)41-22-23-10-5-3-6-11-23)20-31-32-30(35)21-33(25-12-9-13-26(19-25)34(36)37)42(38,39)27-14-7-4-8-15-27/h3-20H,2,21-22H2,1H3,(H,32,35)/b31-20- |
| InChIKey | XEJSQSIKRCPSNB-GTWSWNCMSA-N |
| XLogP | 4.92 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|