C23H22N4O6S — CID 126034061
2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 126034061) has the molecular formula C23H22N4O6S and a molecular weight of 482.52 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126034061 |
| Molecular Formula | C23H22N4O6S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-(2-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccccc1OCc1ccccc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H22N4O6S/c1-34(31,32)26(20-11-7-12-21(14-20)27(29)30)16-23(28)25-24-15-19-10-5-6-13-22(19)33-17-18-8-3-2-4-9-18/h2-15H,16-17H2,1H3,(H,25,28)/b24-15- |
| InChIKey | MEBXFTHKWQLDMZ-IWIPYMOSSA-N |
| XLogP | 3.09 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|