C15H15N5O5S — CID 126032717
2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-pyridin-2-ylmethylideneamino]acetamide (PubChem CID 126032717) has the molecular formula C15H15N5O5S and a molecular weight of 377.38 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-pyridin-2-ylmethylideneamino]acetamide.
| Compound Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-pyridin-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 126032717 |
| Molecular Formula | C15H15N5O5S |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-pyridin-2-ylmethylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccccn1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H15N5O5S/c1-26(24,25)19(13-6-4-7-14(9-13)20(22)23)11-15(21)18-17-10-12-5-2-3-8-16-12/h2-10H,11H2,1H3,(H,18,21)/b17-10- |
| InChIKey | INOPRCSFRNHRHQ-YVLHZVERSA-N |
| XLogP | 0.91 |
| TPSA | 134.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|