C17H17N5O7S — CID 126033899
2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide (PubChem CID 126033899) has the molecular formula C17H17N5O7S and a molecular weight of 435.42 g/mol. Its IUPAC name is 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 126033899 |
| Molecular Formula | C17H17N5O7S |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 2-(N-methylsulfonyl-3-nitroanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN(c1cccc([N+](=O)[O-])c1)S(C)(=O)=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H17N5O7S/c1-12(13-6-8-14(9-7-13)21(24)25)18-19-17(23)11-20(30(2,28)29)15-4-3-5-16(10-15)22(26)27/h3-10H,11H2,1-2H3,(H,19,23)/b18-12- |
| InChIKey | CHGZQXPOMXCGTL-PDGQHHTCSA-N |
| XLogP | 1.81 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|