C24H24N4O7S — CID 126148217
2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide (PubChem CID 126148217) has the molecular formula C24H24N4O7S and a molecular weight of 512.54 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 126148217 |
| Molecular Formula | C24H24N4O7S |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)-N-[(Z)-1-(4-nitrophenyl)ethylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C(/C)c2ccc([N+](=O)[O-])cc2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H24N4O7S/c1-17(18-9-11-20(12-10-18)28(30)31)25-26-24(29)16-27(19-7-5-4-6-8-19)36(32,33)21-13-14-22(34-2)23(15-21)35-3/h4-15H,16H2,1-3H3,(H,26,29)/b25-17- |
| InChIKey | KHIKWOJGTIQGNK-UQQQWYQISA-N |
| XLogP | 3.35 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|