C26H28BrN3O5S — CID 124544498
N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide (PubChem CID 124544498) has the molecular formula C26H28BrN3O5S and a molecular weight of 574.50 g/mol. Its IUPAC name is N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide.
| Compound Name | N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 124544498 |
| Molecular Formula | C26H28BrN3O5S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 573.09 |
| IUPAC Name | N-[(Z)-1-(3-bromophenyl)ethylideneamino]-2-(N-(3,4-dimethoxyphenyl)sulfonyl-3,5-dimethylanilino)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C(/C)c2cccc(Br)c2)c2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C26H28BrN3O5S/c1-17-11-18(2)13-22(12-17)30(36(32,33)23-9-10-24(34-4)25(15-23)35-5)16-26(31)29-28-19(3)20-7-6-8-21(27)14-20/h6-15H,16H2,1-5H3,(H,29,31)/b28-19- |
| InChIKey | ZQEFTGUUTDEQPF-USHMODERSA-N |
| XLogP | 4.82 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|