C23H25N3O5S2 — CID 27046938
2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[(E)-1-thiophen-2-ylethylideneamino]acetamide (PubChem CID 27046938) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[(E)-1-thiophen-2-ylethylideneamino]acetamide.
| Compound Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[(E)-1-thiophen-2-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 27046938 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-methylanilino)-N-[(E)-1-thiophen-2-ylethylideneamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)N/N=C(\C)c2cccs2)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C23H25N3O5S2/c1-16-7-9-18(10-8-16)26(15-23(27)25-24-17(2)22-6-5-13-32-22)33(28,29)19-11-12-20(30-3)21(14-19)31-4/h5-14H,15H2,1-4H3,(H,25,27)/b24-17+ |
| InChIKey | STHGVTQHEXYRSP-JJIBRWJFSA-N |
| XLogP | 3.81 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|