C20H18IN3O3S2 — CID 126144613
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide (PubChem CID 126144613) has the molecular formula C20H18IN3O3S2 and a molecular weight of 539.42 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 126144613 |
| Molecular Formula | C20H18IN3O3S2 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 538.98 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-[(Z)-1-thiophen-2-ylethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C20H18IN3O3S2/c1-15(19-8-5-13-28-19)22-23-20(25)14-24(17-11-9-16(21)10-12-17)29(26,27)18-6-3-2-4-7-18/h2-13H,14H2,1H3,(H,23,25)/b22-15- |
| InChIKey | ZWTSNDYTHOIYCJ-JCMHNJIXSA-N |
| XLogP | 4.09 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|