C19H20IN3O3S — CID 126139179
2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(cyclopentylideneamino)acetamide (PubChem CID 126139179) has the molecular formula C19H20IN3O3S and a molecular weight of 497.36 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(cyclopentylideneamino)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(cyclopentylideneamino)acetamide |
|---|---|
| PubChem CID | 126139179 |
| Molecular Formula | C19H20IN3O3S |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-4-iodoanilino]-N-(cyclopentylideneamino)acetamide |
| SMILES | O=C(CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1)NN=C1CCCC1 |
| InChI | InChI=1S/C19H20IN3O3S/c20-15-10-12-17(13-11-15)23(27(25,26)18-8-2-1-3-9-18)14-19(24)22-21-16-6-4-5-7-16/h1-3,8-13H,4-7,14H2,(H,22,24) |
| InChIKey | KNLZZXAHPRDBOG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|