C15H21IN4O3S — CID 5177317
2-(4-iodo-N-methylsulfonylanilino)-N-[(1-methylpiperidin-4-ylidene)amino]acetamide (PubChem CID 5177317) has the molecular formula C15H21IN4O3S and a molecular weight of 464.33 g/mol. Its IUPAC name is 2-(4-iodo-N-methylsulfonylanilino)-N-[(1-methylpiperidin-4-ylidene)amino]acetamide.
| Compound Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(1-methylpiperidin-4-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 5177317 |
| Molecular Formula | C15H21IN4O3S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 464.04 |
| IUPAC Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(1-methylpiperidin-4-ylidene)amino]acetamide |
| SMILES | CN1CCC(=NNC(=O)CN(c2ccc(I)cc2)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C15H21IN4O3S/c1-19-9-7-13(8-10-19)17-18-15(21)11-20(24(2,22)23)14-5-3-12(16)4-6-14/h3-6H,7-11H2,1-2H3,(H,18,21) |
| InChIKey | MQLPTKFYPHLRKI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|