C16H15IN4O5S — CID 126031270
2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide (PubChem CID 126031270) has the molecular formula C16H15IN4O5S and a molecular weight of 502.29 g/mol. Its IUPAC name is 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 126031270 |
| Molecular Formula | C16H15IN4O5S |
| Molecular Weight | 502.29 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | 2-(4-iodo-N-methylsulfonylanilino)-N-[(Z)-(4-nitrophenyl)methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccc([N+](=O)[O-])cc1)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H15IN4O5S/c1-27(25,26)20(14-8-4-13(17)5-9-14)11-16(22)19-18-10-12-2-6-15(7-3-12)21(23)24/h2-10H,11H2,1H3,(H,19,22)/b18-10- |
| InChIKey | NLSLYDDGPPHGEA-ZDLGFXPLSA-N |
| XLogP | 2.12 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|