C21H17N5O7S — CID 28588758
N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 28588758) has the molecular formula C21H17N5O7S and a molecular weight of 483.46 g/mol. Its IUPAC name is N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 28588758 |
| Molecular Formula | C21H17N5O7S |
| Molecular Weight | 483.46 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | N-[(Z)-(4-nitrophenyl)methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-])N/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H17N5O7S/c27-21(23-22-14-16-10-12-18(13-11-16)25(28)29)15-24(17-6-2-1-3-7-17)34(32,33)20-9-5-4-8-19(20)26(30)31/h1-14H,15H2,(H,23,27)/b22-14- |
| InChIKey | QKFLTJDHWRBBQF-HMAPJEAMSA-N |
| XLogP | 2.85 |
| TPSA | 165.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|