C25H18Cl2N4O6S — CID 6033940
N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide (PubChem CID 6033940) has the molecular formula C25H18Cl2N4O6S and a molecular weight of 573.41 g/mol. Its IUPAC name is N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide.
| Compound Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 6033940 |
| Molecular Formula | C25H18Cl2N4O6S |
| Molecular Weight | 573.41 g/mol |
| Exact Mass | 572.03 |
| IUPAC Name | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(N-(2-nitrophenyl)sulfonylanilino)acetamide |
| SMILES | O=C(CN(c1ccccc1)S(=O)(=O)c1ccccc1[N+](=O)[O-])N/N=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C25H18Cl2N4O6S/c26-17-10-12-20(21(27)14-17)23-13-11-19(37-23)15-28-29-25(32)16-30(18-6-2-1-3-7-18)38(35,36)24-9-5-4-8-22(24)31(33)34/h1-15H,16H2,(H,29,32)/b28-15- |
| InChIKey | SLXBZPXBBMFKND-MBTHVWNTSA-N |
| XLogP | 5.51 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|