C20H15Cl4N3O4S — CID 126033637
2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide (PubChem CID 126033637) has the molecular formula C20H15Cl4N3O4S and a molecular weight of 535.24 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126033637 |
| Molecular Formula | C20H15Cl4N3O4S |
| Molecular Weight | 535.24 g/mol |
| Exact Mass | 532.95 |
| IUPAC Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccc(-c2ccc(Cl)cc2Cl)o1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C20H15Cl4N3O4S/c1-32(29,30)27(18-9-13(22)3-6-16(18)23)11-20(28)26-25-10-14-4-7-19(31-14)15-5-2-12(21)8-17(15)24/h2-10H,11H2,1H3,(H,26,28)/b25-10- |
| InChIKey | BCIOMWUQYHVUNW-MRUKODCESA-N |
| XLogP | 5.48 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.24 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|