C15H14Cl2N4O3S — CID 126034348
2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide (PubChem CID 126034348) has the molecular formula C15H14Cl2N4O3S and a molecular weight of 401.28 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide.
| Compound Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 126034348 |
| Molecular Formula | C15H14Cl2N4O3S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 2-(2,5-dichloro-N-methylsulfonylanilino)-N-[(Z)-pyridin-4-ylmethylideneamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)N/N=C\c1ccncc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H14Cl2N4O3S/c1-25(23,24)21(14-8-12(16)2-3-13(14)17)10-15(22)20-19-9-11-4-6-18-7-5-11/h2-9H,10H2,1H3,(H,20,22)/b19-9- |
| InChIKey | INYRVWOJNYNNRW-OCKHKDLRSA-N |
| XLogP | 2.30 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|