C19H17ClF3N3O5S — CID 28589850
methyl 4-[(Z)-[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]benzoate (PubChem CID 28589850) has the molecular formula C19H17ClF3N3O5S and a molecular weight of 491.88 g/mol. Its IUPAC name is methyl 4-[(Z)-[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]benzoate.
| Compound Name | methyl 4-[(Z)-[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 28589850 |
| Molecular Formula | C19H17ClF3N3O5S |
| Molecular Weight | 491.88 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | methyl 4-[(Z)-[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=N\NC(=O)CN(c2cc(C(F)(F)F)ccc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H17ClF3N3O5S/c1-31-18(28)13-5-3-12(4-6-13)10-24-25-17(27)11-26(32(2,29)30)16-9-14(19(21,22)23)7-8-15(16)20/h3-10H,11H2,1-2H3,(H,25,27)/b24-10- |
| InChIKey | VHLNWPHSCOGSSV-VROXFSQNSA-N |
| XLogP | 3.06 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.88 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|