C18H16BrClF3N3O3S — CID 4242485
N-[1-(3-bromophenyl)ethylideneamino]-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide (PubChem CID 4242485) has the molecular formula C18H16BrClF3N3O3S and a molecular weight of 526.76 g/mol. Its IUPAC name is N-[1-(3-bromophenyl)ethylideneamino]-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[1-(3-bromophenyl)ethylideneamino]-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 4242485 |
| Molecular Formula | C18H16BrClF3N3O3S |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 524.97 |
| IUPAC Name | N-[1-(3-bromophenyl)ethylideneamino]-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide |
| SMILES | CC(=NNC(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(C)(=O)=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H16BrClF3N3O3S/c1-11(12-4-3-5-14(19)8-12)24-25-17(27)10-26(30(2,28)29)16-9-13(18(21,22)23)6-7-15(16)20/h3-9H,10H2,1-2H3,(H,25,27) |
| InChIKey | FRLMPGHLXKUTNO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|