C16H13BrClF3N2O3S — CID 1320398
N-(3-bromophenyl)-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide (PubChem CID 1320398) has the molecular formula C16H13BrClF3N2O3S and a molecular weight of 485.71 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(3-bromophenyl)-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 1320398 |
| Molecular Formula | C16H13BrClF3N2O3S |
| Molecular Weight | 485.71 g/mol |
| Exact Mass | 483.95 |
| IUPAC Name | N-(3-bromophenyl)-2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)Nc1cccc(Br)c1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C16H13BrClF3N2O3S/c1-27(25,26)23(9-15(24)22-12-4-2-3-11(17)8-12)14-7-10(16(19,20)21)5-6-13(14)18/h2-8H,9H2,1H3,(H,22,24) |
| InChIKey | RMKRSUYIAMMLII-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |