C23H25ClF3N3O6S — CID 3448496
tert-butyl 2-[4-[[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 3448496) has the molecular formula C23H25ClF3N3O6S and a molecular weight of 563.98 g/mol. Its IUPAC name is tert-butyl 2-[4-[[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3448496 |
| Molecular Formula | C23H25ClF3N3O6S |
| Molecular Weight | 563.98 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | tert-butyl 2-[4-[[[2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(C=NNC(=O)CN(c2cc(C(F)(F)F)ccc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H25ClF3N3O6S/c1-22(2,3)36-21(32)14-35-17-8-5-15(6-9-17)12-28-29-20(31)13-30(37(4,33)34)19-11-16(23(25,26)27)7-10-18(19)24/h5-12H,13-14H2,1-4H3,(H,29,31) |
| InChIKey | CQAAFLWJENZERZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.98 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|