C29H28ClF3N4O6S — CID 124631544
2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124631544) has the molecular formula C29H28ClF3N4O6S and a molecular weight of 653.08 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124631544 |
| Molecular Formula | C29H28ClF3N4O6S |
| Molecular Weight | 653.08 g/mol |
| Exact Mass | 652.14 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)CN(c2cc(C(F)(F)F)ccc2Cl)S(=O)(=O)c2ccccc2)cc1)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C29H28ClF3N4O6S/c30-25-13-10-21(29(31,32)33)15-26(25)37(44(40,41)24-6-2-1-3-7-24)18-27(38)36-35-16-20-8-11-22(12-9-20)43-19-28(39)34-17-23-5-4-14-42-23/h1-3,6-13,15-16,23H,4-5,14,17-19H2,(H,34,39)(H,36,38)/b35-16-/t23-/m1/s1 |
| InChIKey | ZMMGGUHHTNJRBK-JJCRUMQCSA-N |
| XLogP | 4.38 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.08 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|