C32H29F3N4O5S — CID 126191452
2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 126191452) has the molecular formula C32H29F3N4O5S and a molecular weight of 638.67 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126191452 |
| Molecular Formula | C32H29F3N4O5S |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]-N-[(Z)-[4-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | C[C@@H](NC(=O)COc1ccc(/C=N\NC(=O)CN(c2cccc(C(F)(F)F)c2)S(=O)(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H29F3N4O5S/c1-23(25-9-4-2-5-10-25)37-31(41)22-44-28-17-15-24(16-18-28)20-36-38-30(40)21-39(45(42,43)29-13-6-3-7-14-29)27-12-8-11-26(19-27)32(33,34)35/h2-20,23H,21-22H2,1H3,(H,37,41)(H,38,40)/b36-20-/t23-/m1/s1 |
| InChIKey | UBWCCQJECODOJT-BGJZVQJSSA-N |
| XLogP | 5.31 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|